C30H39N3O6S2 — CID 175290691
benzyl-[6-[bis(thiophen-2-ylmethyl)carbamoyloxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid (PubChem CID 175290691) has the molecular formula C30H39N3O6S2 and a molecular weight of 601.79 g/mol. Its IUPAC name is benzyl-[6-[bis(thiophen-2-ylmethyl)carbamoyloxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid.
| Compound Name | benzyl-[6-[bis(thiophen-2-ylmethyl)carbamoyloxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 175290691 |
| Molecular Formula | C30H39N3O6S2 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | benzyl-[6-[bis(thiophen-2-ylmethyl)carbamoyloxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN(Cc1ccccc1)C(=O)O)COC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C30H39N3O6S2/c1-30(2,3)39-27(34)31-24(13-7-8-16-32(28(35)36)19-23-11-5-4-6-12-23)22-38-29(37)33(20-25-14-9-17-40-25)21-26-15-10-18-41-26/h4-6,9-12,14-15,17-18,24H,7-8,13,16,19-22H2,1-3H3,(H,31,34)(H,35,36) |
| InChIKey | KNTAKDBWVDYOAJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|