C29H37N3O5S2 — CID 123204677
benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[thiophene-2-carbonyl(thiophen-2-ylmethyl)amino]hexyl]carbamate (PubChem CID 123204677) has the molecular formula C29H37N3O5S2 and a molecular weight of 571.77 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[thiophene-2-carbonyl(thiophen-2-ylmethyl)amino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[thiophene-2-carbonyl(thiophen-2-ylmethyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 123204677 |
| Molecular Formula | C29H37N3O5S2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[thiophene-2-carbonyl(thiophen-2-ylmethyl)amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)CN(Cc1cccs1)C(=O)c1cccs1 |
| InChI | InChI=1S/C29H37N3O5S2/c1-29(2,3)37-28(35)31-23(13-7-8-16-30-27(34)36-21-22-11-5-4-6-12-22)19-32(20-24-14-9-17-38-24)26(33)25-15-10-18-39-25/h4-6,9-12,14-15,17-18,23H,7-8,13,16,19-21H2,1-3H3,(H,30,34)(H,31,35)/t23-/m0/s1 |
| InChIKey | TVRPUTCZCRDBEO-QHCPKHFHSA-N |
| XLogP | 6.44 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|