C31H41N3O7S2 — CID 118309917
benzyl N-[(5S)-6-[(4-methoxyphenyl)sulfonyl-(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate (PubChem CID 118309917) has the molecular formula C31H41N3O7S2 and a molecular weight of 631.82 g/mol. Its IUPAC name is benzyl N-[(5S)-6-[(4-methoxyphenyl)sulfonyl-(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-[(4-methoxyphenyl)sulfonyl-(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 118309917 |
| Molecular Formula | C31H41N3O7S2 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | benzyl N-[(5S)-6-[(4-methoxyphenyl)sulfonyl-(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccs2)C[C@H](CCCCNC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H41N3O7S2/c1-31(2,3)41-30(36)33-25(13-8-9-19-32-29(35)40-23-24-11-6-5-7-12-24)21-34(22-27-14-10-20-42-27)43(37,38)28-17-15-26(39-4)16-18-28/h5-7,10-12,14-18,20,25H,8-9,13,19,21-23H2,1-4H3,(H,32,35)(H,33,36)/t25-/m0/s1 |
| InChIKey | UASUPIAXPHFLHJ-VWLOTQADSA-N |
| XLogP | 5.94 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|