C31H46N4O7 — CID 122450517
benzyl N-[2-[2-hydroxyethyl-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl]amino]ethyl]carbamate (PubChem CID 122450517) has the molecular formula C31H46N4O7 and a molecular weight of 586.73 g/mol. Its IUPAC name is benzyl N-[2-[2-hydroxyethyl-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-hydroxyethyl-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 122450517 |
| Molecular Formula | C31H46N4O7 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | benzyl N-[2-[2-hydroxyethyl-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(CN(CCO)CCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H46N4O7/c1-31(2,3)42-29(38)32-17-11-10-16-27(34-30(39)41-24-26-14-8-5-9-15-26)22-35(20-21-36)19-18-33-28(37)40-23-25-12-6-4-7-13-25/h4-9,12-15,27,36H,10-11,16-24H2,1-3H3,(H,32,38)(H,33,37)(H,34,39) |
| InChIKey | RHKZJNXPGAMTMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|