C19H32N2O3 — CID 59693746
benzyl N-[(2S)-1-[2-hydroxyethyl(propyl)amino]hexan-2-yl]carbamate (PubChem CID 59693746) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-hydroxyethyl(propyl)amino]hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-hydroxyethyl(propyl)amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59693746 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | benzyl N-[(2S)-1-[2-hydroxyethyl(propyl)amino]hexan-2-yl]carbamate |
| SMILES | CCCC[C@@H](CN(CCC)CCO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H32N2O3/c1-3-5-11-18(15-21(12-4-2)13-14-22)20-19(23)24-16-17-9-7-6-8-10-17/h6-10,18,22H,3-5,11-16H2,1-2H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | IBTLCNFJRXYEDF-SFHVURJKSA-N |
| XLogP | 3.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |