C29H43N3O6S — CID 175290735
benzyl-[6-[butyl(thiophen-2-ylmethyl)carbamoyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid (PubChem CID 175290735) has the molecular formula C29H43N3O6S and a molecular weight of 561.75 g/mol. Its IUPAC name is benzyl-[6-[butyl(thiophen-2-ylmethyl)carbamoyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid.
| Compound Name | benzyl-[6-[butyl(thiophen-2-ylmethyl)carbamoyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 175290735 |
| Molecular Formula | C29H43N3O6S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | benzyl-[6-[butyl(thiophen-2-ylmethyl)carbamoyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
| SMILES | CCCCN(Cc1cccs1)C(=O)OCC(CCCCN(Cc1ccccc1)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43N3O6S/c1-5-6-17-32(21-25-16-12-19-39-25)28(36)37-22-24(30-26(33)38-29(2,3)4)15-10-11-18-31(27(34)35)20-23-13-8-7-9-14-23/h7-9,12-14,16,19,24H,5-6,10-11,15,17-18,20-22H2,1-4H3,(H,30,33)(H,34,35) |
| InChIKey | BKXQPSBJIKRRAH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|