C31H39N5O5 — CID 123808006
[(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl] N-benzylcarbamate (PubChem CID 123808006) has the molecular formula C31H39N5O5 and a molecular weight of 561.68 g/mol. Its IUPAC name is [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl] N-benzylcarbamate.
| Compound Name | [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 123808006 |
| Molecular Formula | C31H39N5O5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl] N-benzylcarbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCOC(=O)NCc1ccccc1)C(=O)N(Cc1ccncc1)Cc1ccncc1 |
| InChI | InChI=1S/C31H39N5O5/c1-31(2,3)41-30(39)35-27(11-7-8-20-40-29(38)34-21-24-9-5-4-6-10-24)28(37)36(22-25-12-16-32-17-13-25)23-26-14-18-33-19-15-26/h4-6,9-10,12-19,27H,7-8,11,20-23H2,1-3H3,(H,34,38)(H,35,39)/t27-/m0/s1 |
| InChIKey | MCFNFCXAUVFATR-MHZLTWQESA-N |
| XLogP | 5.00 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|