C30H39N3O5S2 — CID 123909548
tert-butyl N-[(2S)-6-(benzylcarbamoyloxy)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-N-methylcarbamate (PubChem CID 123909548) has the molecular formula C30H39N3O5S2 and a molecular weight of 585.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-(benzylcarbamoyloxy)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-6-(benzylcarbamoyloxy)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123909548 |
| Molecular Formula | C30H39N3O5S2 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | tert-butyl N-[(2S)-6-(benzylcarbamoyloxy)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](CCCCOC(=O)NCc1ccccc1)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C30H39N3O5S2/c1-30(2,3)38-29(36)32(4)26(16-8-9-17-37-28(35)31-20-23-12-6-5-7-13-23)27(34)33(21-24-14-10-18-39-24)22-25-15-11-19-40-25/h5-7,10-15,18-19,26H,8-9,16-17,20-22H2,1-4H3,(H,31,35)/t26-/m0/s1 |
| InChIKey | SZPSSZZZVUKVCJ-SANMLTNESA-N |
| XLogP | 6.67 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|