C28H37N3O5S3 — CID 175290773
[6-(benzylsulfonylamino)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-tert-butylcarbamic acid (PubChem CID 175290773) has the molecular formula C28H37N3O5S3 and a molecular weight of 591.82 g/mol. Its IUPAC name is [6-(benzylsulfonylamino)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [6-(benzylsulfonylamino)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 175290773 |
| Molecular Formula | C28H37N3O5S3 |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | [6-(benzylsulfonylamino)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(CCCCNS(=O)(=O)Cc1ccccc1)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C28H37N3O5S3/c1-28(2,3)31(27(33)34)25(15-7-8-16-29-39(35,36)21-22-11-5-4-6-12-22)26(32)30(19-23-13-9-17-37-23)20-24-14-10-18-38-24/h4-6,9-14,17-18,25,29H,7-8,15-16,19-21H2,1-3H3,(H,33,34) |
| InChIKey | SSNWIWUREXTKRI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|