C23H25NO3S2 — CID 5167232
N-benzyl-3-[(4-methylphenyl)methylsulfonyl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 5167232) has the molecular formula C23H25NO3S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-benzyl-3-[(4-methylphenyl)methylsulfonyl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-benzyl-3-[(4-methylphenyl)methylsulfonyl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 5167232 |
| Molecular Formula | C23H25NO3S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-benzyl-3-[(4-methylphenyl)methylsulfonyl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | Cc1ccc(CS(=O)(=O)CCC(=O)N(Cc2ccccc2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C23H25NO3S2/c1-19-9-11-21(12-10-19)18-29(26,27)15-13-23(25)24(17-22-8-5-14-28-22)16-20-6-3-2-4-7-20/h2-12,14H,13,15-18H2,1H3 |
| InChIKey | WOYKRRWJXYAECF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |