C17H23N2OS+ — CID 7417837
[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-propylazanium (PubChem CID 7417837) has the molecular formula C17H23N2OS+ and a molecular weight of 303.45 g/mol. Its IUPAC name is [2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-propylazanium.
| Compound Name | [2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-propylazanium |
|---|---|
| PubChem CID | 7417837 |
| Molecular Formula | C17H23N2OS+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-propylazanium |
| SMILES | CCC[NH2+]CC(=O)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-10-18-12-17(20)19(14-16-9-6-11-21-16)13-15-7-4-3-5-8-15/h3-9,11,18H,2,10,12-14H2,1H3/p+1 |
| InChIKey | WRGGAUSOAGCECE-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|