C24H28N2O3S3 — CID 152783987
(2S)-2-[benzenesulfonyl(ethenyl)amino]-N,N-bis(thiophen-2-ylmethyl)hexanamide (PubChem CID 152783987) has the molecular formula C24H28N2O3S3 and a molecular weight of 488.70 g/mol. Its IUPAC name is (2S)-2-[benzenesulfonyl(ethenyl)amino]-N,N-bis(thiophen-2-ylmethyl)hexanamide.
| Compound Name | (2S)-2-[benzenesulfonyl(ethenyl)amino]-N,N-bis(thiophen-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 152783987 |
| Molecular Formula | C24H28N2O3S3 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (2S)-2-[benzenesulfonyl(ethenyl)amino]-N,N-bis(thiophen-2-ylmethyl)hexanamide |
| SMILES | C=CN([C@@H](CCCC)C(=O)N(Cc1cccs1)Cc1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3S3/c1-3-5-15-23(26(4-2)32(28,29)22-13-7-6-8-14-22)24(27)25(18-20-11-9-16-30-20)19-21-12-10-17-31-21/h4,6-14,16-17,23H,2-3,5,15,18-19H2,1H3/t23-/m0/s1 |
| InChIKey | RUJKSTNIVBCSEC-QHCPKHFHSA-N |
| XLogP | 5.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |