C19H24N2O3S2 — CID 78801560
4-(diethylsulfamoyl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 78801560) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 78801560 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-4-13-20(15-17-8-7-14-25-17)19(22)16-9-11-18(12-10-16)26(23,24)21(5-2)6-3/h4,7-12,14H,1,5-6,13,15H2,2-3H3 |
| InChIKey | HXCRURCOKVBVMN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|