C24H32N4O3S2 — CID 55372675
3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 55372675) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55372675 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CCc1nc2cc(S(=O)(=O)N(CC)CC)ccc2n1CC |
| InChI | InChI=1S/C24H32N4O3S2/c1-5-15-26(18-19-10-9-16-32-19)24(29)14-13-23-25-21-17-20(11-12-22(21)28(23)8-4)33(30,31)27(6-2)7-3/h5,9-12,16-17H,1,6-8,13-15,18H2,2-4H3 |
| InChIKey | UCYKYYUORUFCKZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|