C24H34N4O5S — CID 55327935
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate (PubChem CID 55327935) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 55327935 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)CCc1nc2cc(S(=O)(=O)N(CC)CC)ccc2n1CC |
| InChI | InChI=1S/C24H34N4O5S/c1-6-15-26(16-7-2)23(29)18-33-24(30)14-13-22-25-20-17-19(11-12-21(20)28(22)10-5)34(31,32)27(8-3)9-4/h6-7,11-12,17H,1-2,8-10,13-16,18H2,3-5H3 |
| InChIKey | OFPORKXZKXHGNV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|