C18H25N3O3S2 — CID 55452972
4-(diethylsulfamoyl)-1-methyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 55452972) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-1-methyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-1-methyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55452972 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-(diethylsulfamoyl)-1-methyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1cc(S(=O)(=O)N(CC)CC)cn1C |
| InChI | InChI=1S/C18H25N3O3S2/c1-5-10-20(13-15-9-8-11-25-15)18(22)17-12-16(14-19(17)4)26(23,24)21(6-2)7-3/h5,8-9,11-12,14H,1,6-7,10,13H2,2-4H3 |
| InChIKey | GYQUUCRAPLUZJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|