C14H17BrN2O2S — CID 60700789
4-bromo-N-(2-methoxyethyl)-1-methyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 60700789) has the molecular formula C14H17BrN2O2S and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-bromo-N-(2-methoxyethyl)-1-methyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-methoxyethyl)-1-methyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60700789 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-bromo-N-(2-methoxyethyl)-1-methyl-N-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | COCCN(Cc1cccs1)C(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C14H17BrN2O2S/c1-16-9-11(15)8-13(16)14(18)17(5-6-19-2)10-12-4-3-7-20-12/h3-4,7-9H,5-6,10H2,1-2H3 |
| InChIKey | MXDWYQRBQOYWDJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |