C18H25N3O3S2 — CID 41249871
1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2-thiophen-2-ylethyl)urea (PubChem CID 41249871) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 41249871 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2-thiophen-2-ylethyl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H25N3O3S2/c1-3-21(4-2)26(23,24)17-9-7-15(8-10-17)14-20-18(22)19-12-11-16-6-5-13-25-16/h5-10,13H,3-4,11-12,14H2,1-2H3,(H2,19,20,22) |
| InChIKey | LKSWMUGECUEFOO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |