C21H29N3O4S2 — CID 118620773
3-[[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino]butanoic acid (PubChem CID 118620773) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is 3-[[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 3-[[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 118620773 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-[[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino]butanoic acid |
| SMILES | CCCC[C@H](NC(=O)NC(C)CC(=O)O)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-3-4-9-18(23-21(28)22-15(2)12-19(25)26)20(27)24(13-16-7-5-10-29-16)14-17-8-6-11-30-17/h5-8,10-11,15,18H,3-4,9,12-14H2,1-2H3,(H,25,26)(H2,22,23,28)/t15?,18-/m0/s1 |
| InChIKey | KMXBGGFRORUMLL-PKHIMPSTSA-N |
| XLogP | 4.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |