C27H33N3O5S2 — CID 123495586
[(5S)-6-[bis(thiophen-2-ylmethyl)amino]-5-(ethoxycarbonylamino)-6-oxohexyl] N-benzylcarbamate (PubChem CID 123495586) has the molecular formula C27H33N3O5S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is [(5S)-6-[bis(thiophen-2-ylmethyl)amino]-5-(ethoxycarbonylamino)-6-oxohexyl] N-benzylcarbamate.
| Compound Name | [(5S)-6-[bis(thiophen-2-ylmethyl)amino]-5-(ethoxycarbonylamino)-6-oxohexyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 123495586 |
| Molecular Formula | C27H33N3O5S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | [(5S)-6-[bis(thiophen-2-ylmethyl)amino]-5-(ethoxycarbonylamino)-6-oxohexyl] N-benzylcarbamate |
| SMILES | CCOC(=O)N[C@@H](CCCCOC(=O)NCc1ccccc1)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C27H33N3O5S2/c1-2-34-27(33)29-24(14-6-7-15-35-26(32)28-18-21-10-4-3-5-11-21)25(31)30(19-22-12-8-16-36-22)20-23-13-9-17-37-23/h3-5,8-13,16-17,24H,2,6-7,14-15,18-20H2,1H3,(H,28,32)(H,29,33)/t24-/m0/s1 |
| InChIKey | NFZXOTIXLSZRPL-DEOSSOPVSA-N |
| XLogP | 5.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|