C26H31N3O4S2 — CID 175290759
[[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino] (2R)-2-phenylpropanoate (PubChem CID 175290759) has the molecular formula C26H31N3O4S2 and a molecular weight of 513.69 g/mol. Its IUPAC name is [[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino] (2R)-2-phenylpropanoate.
| Compound Name | [[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino] (2R)-2-phenylpropanoate |
|---|---|
| PubChem CID | 175290759 |
| Molecular Formula | C26H31N3O4S2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamoylamino] (2R)-2-phenylpropanoate |
| SMILES | CCCC[C@H](NC(=O)NOC(=O)[C@H](C)c1ccccc1)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C26H31N3O4S2/c1-3-4-14-23(27-26(32)28-33-25(31)19(2)20-10-6-5-7-11-20)24(30)29(17-21-12-8-15-34-21)18-22-13-9-16-35-22/h5-13,15-16,19,23H,3-4,14,17-18H2,1-2H3,(H2,27,28,32)/t19-,23+/m1/s1 |
| InChIKey | OQNQPILBPDKTMC-XXBNENTESA-N |
| XLogP | 5.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|