C22H30F3N3O5S3 — CID 175377998
[1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(trifluoromethylsulfonylamino)hexan-2-yl]-tert-butylcarbamic acid (PubChem CID 175377998) has the molecular formula C22H30F3N3O5S3 and a molecular weight of 569.69 g/mol. Its IUPAC name is [1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(trifluoromethylsulfonylamino)hexan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(trifluoromethylsulfonylamino)hexan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 175377998 |
| Molecular Formula | C22H30F3N3O5S3 |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | [1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(trifluoromethylsulfonylamino)hexan-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(CCCCNS(=O)(=O)C(F)(F)F)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C22H30F3N3O5S3/c1-21(2,3)28(20(30)31)18(10-4-5-11-26-36(32,33)22(23,24)25)19(29)27(14-16-8-6-12-34-16)15-17-9-7-13-35-17/h6-9,12-13,18,26H,4-5,10-11,14-15H2,1-3H3,(H,30,31) |
| InChIKey | XCOSYCWTHJCJLF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|