C26H30N2O3S2 — CID 3913172
N-benzyl-2-[tert-butyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3913172) has the molecular formula C26H30N2O3S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is N-benzyl-2-[tert-butyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[tert-butyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3913172 |
| Molecular Formula | C26H30N2O3S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-benzyl-2-[tert-butyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(C)(C)N(CC(=O)N(Cc1ccccc1)Cc1cccs1)S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2O3S2/c1-26(2,3)28(33(30,31)18-16-22-11-6-4-7-12-22)21-25(29)27(20-24-15-10-17-32-24)19-23-13-8-5-9-14-23/h4-18H,19-21H2,1-3H3 |
| InChIKey | MNZSMVSHESLVSU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |