C25H26N2O3S2 — CID 4566631
N-benzyl-2-[cyclopropyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4566631) has the molecular formula C25H26N2O3S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-benzyl-2-[cyclopropyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclopropyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4566631 |
| Molecular Formula | C25H26N2O3S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-benzyl-2-[cyclopropyl(2-phenylethenylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN(C1CC1)S(=O)(=O)C=Cc1ccccc1)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C25H26N2O3S2/c28-25(26(19-24-12-7-16-31-24)18-22-10-5-2-6-11-22)20-27(23-13-14-23)32(29,30)17-15-21-8-3-1-4-9-21/h1-12,15-17,23H,13-14,18-20H2 |
| InChIKey | QBLTYQZIPCXMMC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |