C26H25N3O3S2 — CID 4998790
N-benzyl-2-[cyclopropyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4998790) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-benzyl-2-[cyclopropyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclopropyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4998790 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-benzyl-2-[cyclopropyl(quinolin-8-ylsulfonyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN(C1CC1)S(=O)(=O)c1cccc2cccnc12)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C26H25N3O3S2/c30-25(28(18-23-11-6-16-33-23)17-20-7-2-1-3-8-20)19-29(22-13-14-22)34(31,32)24-12-4-9-21-10-5-15-27-26(21)24/h1-12,15-16,22H,13-14,17-19H2 |
| InChIKey | PPJGGCUKDORACH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |