C14H19NO4S — CID 19965196
2-[tert-butyl-[(E)-2-phenylethenyl]sulfonylamino]acetic acid (PubChem CID 19965196) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[tert-butyl-[(E)-2-phenylethenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[tert-butyl-[(E)-2-phenylethenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 19965196 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[tert-butyl-[(E)-2-phenylethenyl]sulfonylamino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H19NO4S/c1-14(2,3)15(11-13(16)17)20(18,19)10-9-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,16,17)/b10-9+ |
| InChIKey | IEGZWPFBGJUVIY-MDZDMXLPSA-N |
| XLogP | 2.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |