C16H20F3NO5 — CID 156757817
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethoxy)phenyl]butanoic acid (PubChem CID 156757817) has the molecular formula C16H20F3NO5 and a molecular weight of 363.33 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethoxy)phenyl]butanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 156757817 |
| Molecular Formula | C16H20F3NO5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethoxy)phenyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C16H20F3NO5/c1-15(2,3)25-14(23)20-12(13(21)22)9-6-10-4-7-11(8-5-10)24-16(17,18)19/h4-5,7-8,12H,6,9H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | ULZGTEDIZQYJHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |