C14H18ClNO2S2 — CID 26007241
(2S)-1-[(5-chlorothiophen-2-yl)methyl-methylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 26007241) has the molecular formula C14H18ClNO2S2 and a molecular weight of 331.89 g/mol. Its IUPAC name is (2S)-1-[(5-chlorothiophen-2-yl)methyl-methylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | (2S)-1-[(5-chlorothiophen-2-yl)methyl-methylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 26007241 |
| Molecular Formula | C14H18ClNO2S2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (2S)-1-[(5-chlorothiophen-2-yl)methyl-methylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CN(Cc1ccc(Cl)s1)C[C@H](O)COCc1cccs1 |
| InChI | InChI=1S/C14H18ClNO2S2/c1-16(8-12-4-5-14(15)20-12)7-11(17)9-18-10-13-3-2-6-19-13/h2-6,11,17H,7-10H2,1H3/t11-/m0/s1 |
| InChIKey | OATSTFLZMSUPNQ-NSHDSACASA-N |
| XLogP | 3.47 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |