C22H25NO2S — CID 93164463
(2S)-1-[benzyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 93164463) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is (2S)-1-[benzyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[benzyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 93164463 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2S)-1-[benzyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OC[C@@H](O)CN(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C22H25NO2S/c1-18-8-5-6-12-22(18)25-17-20(24)15-23(16-21-11-7-13-26-21)14-19-9-3-2-4-10-19/h2-13,20,24H,14-17H2,1H3/t20-/m0/s1 |
| InChIKey | KRXJGZBRGJCCQC-FQEVSTJZSA-N |
| XLogP | 4.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |