C24H26FNO2 — CID 93164915
(2S)-1-[benzyl-[(3-fluorophenyl)methyl]amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 93164915) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is (2S)-1-[benzyl-[(3-fluorophenyl)methyl]amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[benzyl-[(3-fluorophenyl)methyl]amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 93164915 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2S)-1-[benzyl-[(3-fluorophenyl)methyl]amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OC[C@@H](O)CN(Cc1ccccc1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H26FNO2/c1-19-8-5-6-13-24(19)28-18-23(27)17-26(15-20-9-3-2-4-10-20)16-21-11-7-12-22(25)14-21/h2-14,23,27H,15-18H2,1H3/t23-/m0/s1 |
| InChIKey | PZVOSXFYJLUHQP-QHCPKHFHSA-N |
| XLogP | 4.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |