C20H26FNO2 — CID 93164105
(2R)-1-[(4-fluorophenyl)methyl-propan-2-ylamino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 93164105) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is (2R)-1-[(4-fluorophenyl)methyl-propan-2-ylamino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[(4-fluorophenyl)methyl-propan-2-ylamino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 93164105 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2R)-1-[(4-fluorophenyl)methyl-propan-2-ylamino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OC[C@H](O)CN(Cc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C20H26FNO2/c1-15(2)22(12-17-8-10-18(21)11-9-17)13-19(23)14-24-20-7-5-4-6-16(20)3/h4-11,15,19,23H,12-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | FTRHOUABDLLNBQ-LJQANCHMSA-N |
| XLogP | 3.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |