C22H24FNO2S — CID 46007797
1-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 46007797) has the molecular formula C22H24FNO2S and a molecular weight of 385.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 46007797 |
| Molecular Formula | C22H24FNO2S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl-(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OCC(O)CN(Cc1ccc(F)cc1)Cc1cccs1 |
| InChI | InChI=1S/C22H24FNO2S/c1-17-5-2-3-7-22(17)26-16-20(25)14-24(15-21-6-4-12-27-21)13-18-8-10-19(23)11-9-18/h2-12,20,25H,13-16H2,1H3 |
| InChIKey | NQOKTDHUWAQBBP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |