C19H25NO3S — CID 42837187
[3-[benzyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate (PubChem CID 42837187) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is [3-[benzyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate.
| Compound Name | [3-[benzyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 42837187 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [3-[benzyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OCC(O)CN(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C19H25NO3S/c1-2-7-19(22)23-15-17(21)13-20(14-18-10-6-11-24-18)12-16-8-4-3-5-9-16/h3-6,8-11,17,21H,2,7,12-15H2,1H3 |
| InChIKey | YOFLQRSMZKRKRS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |