C15H23NO3S — CID 93147255
[(2R)-3-[cyclopropyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate (PubChem CID 93147255) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is [(2R)-3-[cyclopropyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate.
| Compound Name | [(2R)-3-[cyclopropyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 93147255 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(2R)-3-[cyclopropyl(thiophen-2-ylmethyl)amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](O)CN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C15H23NO3S/c1-2-4-15(18)19-11-13(17)9-16(12-6-7-12)10-14-5-3-8-20-14/h3,5,8,12-13,17H,2,4,6-7,9-11H2,1H3/t13-/m1/s1 |
| InChIKey | SURNVZBQPLDYPC-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |