C20H27NO5 — CID 93163907
[(2S)-3-[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate (PubChem CID 93163907) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [(2S)-3-[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate.
| Compound Name | [(2S)-3-[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 93163907 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [(2S)-3-[furan-2-ylmethyl-[(4-methoxyphenyl)methyl]amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](O)CN(Cc1ccc(OC)cc1)Cc1ccco1 |
| InChI | InChI=1S/C20H27NO5/c1-3-5-20(23)26-15-17(22)13-21(14-19-6-4-11-25-19)12-16-7-9-18(24-2)10-8-16/h4,6-11,17,22H,3,5,12-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | KUJMWDBPYSLJBS-KRWDZBQOSA-N |
| XLogP | 2.99 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |