C19H31NO4 — CID 42836939
[2-hydroxy-3-[(4-methoxyphenyl)methyl-(2-methylpropyl)amino]propyl] butanoate (PubChem CID 42836939) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is [2-hydroxy-3-[(4-methoxyphenyl)methyl-(2-methylpropyl)amino]propyl] butanoate.
| Compound Name | [2-hydroxy-3-[(4-methoxyphenyl)methyl-(2-methylpropyl)amino]propyl] butanoate |
|---|---|
| PubChem CID | 42836939 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [2-hydroxy-3-[(4-methoxyphenyl)methyl-(2-methylpropyl)amino]propyl] butanoate |
| SMILES | CCCC(=O)OCC(O)CN(Cc1ccc(OC)cc1)CC(C)C |
| InChI | InChI=1S/C19H31NO4/c1-5-6-19(22)24-14-17(21)13-20(11-15(2)3)12-16-7-9-18(23-4)10-8-16/h7-10,15,17,21H,5-6,11-14H2,1-4H3 |
| InChIKey | BBGJNRRAVGJELK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |