C17H23NO4S — CID 93162504
[(2R)-3-[furan-2-ylmethyl(thiophen-3-ylmethyl)amino]-2-hydroxypropyl] butanoate (PubChem CID 93162504) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is [(2R)-3-[furan-2-ylmethyl(thiophen-3-ylmethyl)amino]-2-hydroxypropyl] butanoate.
| Compound Name | [(2R)-3-[furan-2-ylmethyl(thiophen-3-ylmethyl)amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 93162504 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(2R)-3-[furan-2-ylmethyl(thiophen-3-ylmethyl)amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](O)CN(Cc1ccsc1)Cc1ccco1 |
| InChI | InChI=1S/C17H23NO4S/c1-2-4-17(20)22-12-15(19)10-18(9-14-6-8-23-13-14)11-16-5-3-7-21-16/h3,5-8,13,15,19H,2,4,9-12H2,1H3/t15-/m1/s1 |
| InChIKey | ACORNCCLWGWBMC-OAHLLOKOSA-N |
| XLogP | 3.05 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |