C22H32N2O4 — CID 4851497
1-[bis(4-methoxyphenyl)methoxy]-3-[2-(dimethylamino)ethylamino]propan-2-ol (PubChem CID 4851497) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)methoxy]-3-[2-(dimethylamino)ethylamino]propan-2-ol.
| Compound Name | 1-[bis(4-methoxyphenyl)methoxy]-3-[2-(dimethylamino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 4851497 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)methoxy]-3-[2-(dimethylamino)ethylamino]propan-2-ol |
| SMILES | COc1ccc(C(OCC(O)CNCCN(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-24(2)14-13-23-15-19(25)16-28-22(17-5-9-20(26-3)10-6-17)18-7-11-21(27-4)12-8-18/h5-12,19,22-23,25H,13-16H2,1-4H3 |
| InChIKey | VNEZMXDNASMTQR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|