C26H35NO4 — CID 2093316
(2S)-1-[bis(4-methoxyphenyl)methoxy]-3-[2-(cyclohexen-1-yl)ethylamino]propan-2-ol (PubChem CID 2093316) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (2S)-1-[bis(4-methoxyphenyl)methoxy]-3-[2-(cyclohexen-1-yl)ethylamino]propan-2-ol.
| Compound Name | (2S)-1-[bis(4-methoxyphenyl)methoxy]-3-[2-(cyclohexen-1-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 2093316 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (2S)-1-[bis(4-methoxyphenyl)methoxy]-3-[2-(cyclohexen-1-yl)ethylamino]propan-2-ol |
| SMILES | COc1ccc(C(OC[C@@H](O)CNCCC2=CCCCC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-29-24-12-8-21(9-13-24)26(22-10-14-25(30-2)15-11-22)31-19-23(28)18-27-17-16-20-6-4-3-5-7-20/h6,8-15,23,26-28H,3-5,7,16-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | BFKHWMWJPBLMHI-QHCPKHFHSA-N |
| XLogP | 4.65 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|