C25H29FNO4+ — CID 2127391
[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2-fluorophenyl)methyl]azanium (PubChem CID 2127391) has the molecular formula C25H29FNO4+ and a molecular weight of 426.51 g/mol. Its IUPAC name is [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2-fluorophenyl)methyl]azanium.
| Compound Name | [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 2127391 |
| Molecular Formula | C25H29FNO4+ |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2-fluorophenyl)methyl]azanium |
| SMILES | COc1ccc(C(OC[C@@H](O)C[NH2+]Cc2ccccc2F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28FNO4/c1-29-22-11-7-18(8-12-22)25(19-9-13-23(30-2)14-10-19)31-17-21(28)16-27-15-20-5-3-4-6-24(20)26/h3-14,21,25,27-28H,15-17H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | ZFTDVXNPRFPKNW-NRFANRHFSA-O |
| XLogP | 3.07 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |