C23H24F2NO+ — CID 7707372
[(3R)-3-(4-fluorophenyl)-3-(4-methoxyphenyl)propyl]-[(2-fluorophenyl)methyl]azanium (PubChem CID 7707372) has the molecular formula C23H24F2NO+ and a molecular weight of 368.45 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)-3-(4-methoxyphenyl)propyl]-[(2-fluorophenyl)methyl]azanium.
| Compound Name | [(3R)-3-(4-fluorophenyl)-3-(4-methoxyphenyl)propyl]-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7707372 |
| Molecular Formula | C23H24F2NO+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)-3-(4-methoxyphenyl)propyl]-[(2-fluorophenyl)methyl]azanium |
| SMILES | COc1ccc([C@@H](CC[NH2+]Cc2ccccc2F)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H23F2NO/c1-27-21-12-8-18(9-13-21)22(17-6-10-20(24)11-7-17)14-15-26-16-19-4-2-3-5-23(19)25/h2-13,22,26H,14-16H2,1H3/p+1/t22-/m0/s1 |
| InChIKey | KQVIYHJSXGPHKZ-QFIPXVFZSA-O |
| XLogP | 4.26 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|