C16H26NO4+ — CID 2144762
[(2R)-1-hydroxybutan-2-yl]-[(2S)-2-hydroxy-3-(4-propanoylphenoxy)propyl]azanium (PubChem CID 2144762) has the molecular formula C16H26NO4+ and a molecular weight of 296.39 g/mol. Its IUPAC name is [(2R)-1-hydroxybutan-2-yl]-[(2S)-2-hydroxy-3-(4-propanoylphenoxy)propyl]azanium.
| Compound Name | [(2R)-1-hydroxybutan-2-yl]-[(2S)-2-hydroxy-3-(4-propanoylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2144762 |
| Molecular Formula | C16H26NO4+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | [(2R)-1-hydroxybutan-2-yl]-[(2S)-2-hydroxy-3-(4-propanoylphenoxy)propyl]azanium |
| SMILES | CCC(=O)c1ccc(OC[C@@H](O)C[NH2+][C@H](CC)CO)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-3-13(10-18)17-9-14(19)11-21-15-7-5-12(6-8-15)16(20)4-2/h5-8,13-14,17-19H,3-4,9-11H2,1-2H3/p+1/t13-,14+/m1/s1 |
| InChIKey | QSCNSJFTLJKABL-KGLIPLIRSA-O |
| XLogP | 0.35 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |