C19H25Cl2NO2 — CID 138960082
1-(2-chlorophenoxy)-3-[1-(4-methylphenyl)propylamino]propan-2-ol;hydrochloride (PubChem CID 138960082) has the molecular formula C19H25Cl2NO2 and a molecular weight of 370.32 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-[1-(4-methylphenyl)propylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-(2-chlorophenoxy)-3-[1-(4-methylphenyl)propylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138960082 |
| Molecular Formula | C19H25Cl2NO2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-[1-(4-methylphenyl)propylamino]propan-2-ol;hydrochloride |
| SMILES | CCC(NCC(O)COc1ccccc1Cl)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C19H24ClNO2.ClH/c1-3-18(15-10-8-14(2)9-11-15)21-12-16(22)13-23-19-7-5-4-6-17(19)20;/h4-11,16,18,21-22H,3,12-13H2,1-2H3;1H |
| InChIKey | ZXHCCAJQJWFJSJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |