C14H23NO — CID 115899605
1-[1-(4-methylphenyl)propylamino]butan-2-ol (PubChem CID 115899605) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)propylamino]butan-2-ol.
| Compound Name | 1-[1-(4-methylphenyl)propylamino]butan-2-ol |
|---|---|
| PubChem CID | 115899605 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-[1-(4-methylphenyl)propylamino]butan-2-ol |
| SMILES | CCC(O)CNC(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H23NO/c1-4-13(16)10-15-14(5-2)12-8-6-11(3)7-9-12/h6-9,13-16H,4-5,10H2,1-3H3 |
| InChIKey | KIJWVVUFUTVHBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |