C21H28ClNO3 — CID 138960102
1-[4-[2-hydroxy-3-[1-(4-methylphenyl)propylamino]propoxy]phenyl]ethanone;hydrochloride (PubChem CID 138960102) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-[1-(4-methylphenyl)propylamino]propoxy]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-[2-hydroxy-3-[1-(4-methylphenyl)propylamino]propoxy]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 138960102 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[4-[2-hydroxy-3-[1-(4-methylphenyl)propylamino]propoxy]phenyl]ethanone;hydrochloride |
| SMILES | CCC(NCC(O)COc1ccc(C(C)=O)cc1)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C21H27NO3.ClH/c1-4-21(18-7-5-15(2)6-8-18)22-13-19(24)14-25-20-11-9-17(10-12-20)16(3)23;/h5-12,19,21-22,24H,4,13-14H2,1-3H3;1H |
| InChIKey | CUYQLIWURGYCHW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |