C19H23BrClNO2 — CID 2561544
(2R)-1-[[(1S)-1-(4-bromophenyl)propyl]amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol (PubChem CID 2561544) has the molecular formula C19H23BrClNO2 and a molecular weight of 412.76 g/mol. Its IUPAC name is (2R)-1-[[(1S)-1-(4-bromophenyl)propyl]amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-[[(1S)-1-(4-bromophenyl)propyl]amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 2561544 |
| Molecular Formula | C19H23BrClNO2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (2R)-1-[[(1S)-1-(4-bromophenyl)propyl]amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol |
| SMILES | CC[C@H](NC[C@@H](O)COCc1ccccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrClNO2/c1-2-19(14-7-9-16(20)10-8-14)22-11-17(23)13-24-12-15-5-3-4-6-18(15)21/h3-10,17,19,22-23H,2,11-13H2,1H3/t17-,19+/m1/s1 |
| InChIKey | COPLWPMLFGPMNU-MJGOQNOKSA-N |
| XLogP | 4.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |