C14H20ClNO4 — CID 61499471
methyl 2-[[3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]amino]propanoate (PubChem CID 61499471) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is methyl 2-[[3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]amino]propanoate.
| Compound Name | methyl 2-[[3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]amino]propanoate |
|---|---|
| PubChem CID | 61499471 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 2-[[3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]amino]propanoate |
| SMILES | COC(=O)C(C)NCC(O)COCc1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO4/c1-10(14(18)19-2)16-7-12(17)9-20-8-11-5-3-4-6-13(11)15/h3-6,10,12,16-17H,7-9H2,1-2H3 |
| InChIKey | VTIKLJVOZOVNLL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |