C13H16ClNO4 — CID 87040393
methyl (2S)-2-[[2-[(2-chlorophenyl)methoxy]acetyl]amino]propanoate (PubChem CID 87040393) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[(2-chlorophenyl)methoxy]acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-[(2-chlorophenyl)methoxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 87040393 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl (2S)-2-[[2-[(2-chlorophenyl)methoxy]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)COCc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClNO4/c1-9(13(17)18-2)15-12(16)8-19-7-10-5-3-4-6-11(10)14/h3-6,9H,7-8H2,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | UUUMUBNZFDDOJD-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |