C16H21NO5S — CID 14647133
[(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-yl] hydrogen sulfate (PubChem CID 14647133) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is [(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-yl] hydrogen sulfate.
| Compound Name | [(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 14647133 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-yl] hydrogen sulfate |
| SMILES | CC(C)NC[C@H](COc1cccc2ccccc12)OS(=O)(=O)O |
| InChI | InChI=1S/C16H21NO5S/c1-12(2)17-10-14(22-23(18,19)20)11-21-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17H,10-11H2,1-2H3,(H,18,19,20)/t14-/m1/s1 |
| InChIKey | KELUCDAMKVBJTE-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|