C22H36N2O3 — CID 14853059
N-hexyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-prop-2-enylbenzamide (PubChem CID 14853059) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is N-hexyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-prop-2-enylbenzamide.
| Compound Name | N-hexyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 14853059 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-hexyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCCCCCC)ccc1OCC(O)CNC(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-5-7-8-9-13-23-22(26)19-11-12-21(18(14-19)10-6-2)27-16-20(25)15-24-17(3)4/h6,11-12,14,17,20,24-25H,2,5,7-10,13,15-16H2,1,3-4H3,(H,23,26) |
| InChIKey | AFHWVCKYASNHCT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|